C16H14BrF2O5P — CID 91295352
[[2-bromo-4-[(2-methoxycarbonylphenyl)methyl]phenyl]-difluoromethyl]phosphonic acid (PubChem CID 91295352) has the molecular formula C16H14BrF2O5P and a molecular weight of 435.16 g/mol. Its IUPAC name is [[2-bromo-4-[(2-methoxycarbonylphenyl)methyl]phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[2-bromo-4-[(2-methoxycarbonylphenyl)methyl]phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 91295352 |
| Molecular Formula | C16H14BrF2O5P |
| Molecular Weight | 435.16 g/mol |
| Exact Mass | 433.97 |
| IUPAC Name | [[2-bromo-4-[(2-methoxycarbonylphenyl)methyl]phenyl]-difluoromethyl]phosphonic acid |
| SMILES | COC(=O)c1ccccc1Cc1ccc(C(F)(F)P(=O)(O)O)c(Br)c1 |
| InChI | InChI=1S/C16H14BrF2O5P/c1-24-15(20)12-5-3-2-4-11(12)8-10-6-7-13(14(17)9-10)16(18,19)25(21,22)23/h2-7,9H,8H2,1H3,(H2,21,22,23) |
| InChIKey | SKBLXTMVDCRTAX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.16 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|