C16H16BrF2O4P — CID 10273687
[[2-bromo-4-(2-phenylethoxymethyl)phenyl]-difluoromethyl]phosphonic acid (PubChem CID 10273687) has the molecular formula C16H16BrF2O4P and a molecular weight of 421.17 g/mol. Its IUPAC name is [[2-bromo-4-(2-phenylethoxymethyl)phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[2-bromo-4-(2-phenylethoxymethyl)phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 10273687 |
| Molecular Formula | C16H16BrF2O4P |
| Molecular Weight | 421.17 g/mol |
| Exact Mass | 419.99 |
| IUPAC Name | [[2-bromo-4-(2-phenylethoxymethyl)phenyl]-difluoromethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(F)(F)c1ccc(COCCc2ccccc2)cc1Br |
| InChI | InChI=1S/C16H16BrF2O4P/c17-15-10-13(6-7-14(15)16(18,19)24(20,21)22)11-23-9-8-12-4-2-1-3-5-12/h1-7,10H,8-9,11H2,(H2,20,21,22) |
| InChIKey | VSZNETVTMCSNHT-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.17 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|