C15H12Br2F3O3PS — CID 10311567
[[2-bromo-4-[(2-bromo-5-fluorophenyl)methylsulfanylmethyl]phenyl]-difluoromethyl]phosphonic acid (PubChem CID 10311567) has the molecular formula C15H12Br2F3O3PS and a molecular weight of 520.10 g/mol. Its IUPAC name is [[2-bromo-4-[(2-bromo-5-fluorophenyl)methylsulfanylmethyl]phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[2-bromo-4-[(2-bromo-5-fluorophenyl)methylsulfanylmethyl]phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 10311567 |
| Molecular Formula | C15H12Br2F3O3PS |
| Molecular Weight | 520.10 g/mol |
| Exact Mass | 517.86 |
| IUPAC Name | [[2-bromo-4-[(2-bromo-5-fluorophenyl)methylsulfanylmethyl]phenyl]-difluoromethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(F)(F)c1ccc(CSCc2cc(F)ccc2Br)cc1Br |
| InChI | InChI=1S/C15H12Br2F3O3PS/c16-13-4-2-11(18)6-10(13)8-25-7-9-1-3-12(14(17)5-9)15(19,20)24(21,22)23/h1-6H,7-8H2,(H2,21,22,23) |
| InChIKey | VMRQZQIETNNZRM-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.10 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|