C14H11BrF3O4P — CID 10179796
[[2-bromo-4-[(4-fluorophenoxy)methyl]phenyl]-difluoromethyl]phosphonic acid (PubChem CID 10179796) has the molecular formula C14H11BrF3O4P and a molecular weight of 411.11 g/mol. Its IUPAC name is [[2-bromo-4-[(4-fluorophenoxy)methyl]phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[2-bromo-4-[(4-fluorophenoxy)methyl]phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 10179796 |
| Molecular Formula | C14H11BrF3O4P |
| Molecular Weight | 411.11 g/mol |
| Exact Mass | 409.95 |
| IUPAC Name | [[2-bromo-4-[(4-fluorophenoxy)methyl]phenyl]-difluoromethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(F)(F)c1ccc(COc2ccc(F)cc2)cc1Br |
| InChI | InChI=1S/C14H11BrF3O4P/c15-13-7-9(8-22-11-4-2-10(16)3-5-11)1-6-12(13)14(17,18)23(19,20)21/h1-7H,8H2,(H2,19,20,21) |
| InChIKey | LJXLFHHMHIWHHN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.11 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|