C7H5BrF3O3P — CID 11645166
[(2-bromo-4-fluorophenyl)-difluoromethyl]phosphonic acid (PubChem CID 11645166) has the molecular formula C7H5BrF3O3P and a molecular weight of 304.99 g/mol. Its IUPAC name is [(2-bromo-4-fluorophenyl)-difluoromethyl]phosphonic acid.
| Compound Name | [(2-bromo-4-fluorophenyl)-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 11645166 |
| Molecular Formula | C7H5BrF3O3P |
| Molecular Weight | 304.99 g/mol |
| Exact Mass | 303.91 |
| IUPAC Name | [(2-bromo-4-fluorophenyl)-difluoromethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(F)(F)c1ccc(F)cc1Br |
| InChI | InChI=1S/C7H5BrF3O3P/c8-6-3-4(9)1-2-5(6)7(10,11)15(12,13)14/h1-3H,(H2,12,13,14) |
| InChIKey | LZZYKIFPEUOMJK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.99 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|