C21H19BrF2NO3PS — CID 18342279
[[2-bromo-4-[(1-phenyl-2-pyridin-4-ylethyl)sulfanylmethyl]phenyl]-difluoromethyl]phosphonic acid (PubChem CID 18342279) has the molecular formula C21H19BrF2NO3PS and a molecular weight of 514.33 g/mol. Its IUPAC name is [[2-bromo-4-[(1-phenyl-2-pyridin-4-ylethyl)sulfanylmethyl]phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[2-bromo-4-[(1-phenyl-2-pyridin-4-ylethyl)sulfanylmethyl]phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 18342279 |
| Molecular Formula | C21H19BrF2NO3PS |
| Molecular Weight | 514.33 g/mol |
| Exact Mass | 513.00 |
| IUPAC Name | [[2-bromo-4-[(1-phenyl-2-pyridin-4-ylethyl)sulfanylmethyl]phenyl]-difluoromethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(F)(F)c1ccc(CSC(Cc2ccncc2)c2ccccc2)cc1Br |
| InChI | InChI=1S/C21H19BrF2NO3PS/c22-19-12-16(6-7-18(19)21(23,24)29(26,27)28)14-30-20(17-4-2-1-3-5-17)13-15-8-10-25-11-9-15/h1-12,20H,13-14H2,(H2,26,27,28) |
| InChIKey | YFRZFEFZEVWFRP-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.33 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|