C17H16BrF2Na2O3PS — CID 18342276
disodium;[[2-bromo-4-(1-phenylpropan-2-ylsulfanylmethyl)phenyl]-difluoromethyl]-dioxido-oxo-λ5-phosphane (PubChem CID 18342276) has the molecular formula C17H16BrF2Na2O3PS and a molecular weight of 495.23 g/mol. Its IUPAC name is disodium;[[2-bromo-4-(1-phenylpropan-2-ylsulfanylmethyl)phenyl]-difluoromethyl]-dioxido-oxo-λ5-phosphane.
| Compound Name | disodium;[[2-bromo-4-(1-phenylpropan-2-ylsulfanylmethyl)phenyl]-difluoromethyl]-dioxido-oxo-λ5-phosphane |
|---|---|
| PubChem CID | 18342276 |
| Molecular Formula | C17H16BrF2Na2O3PS |
| Molecular Weight | 495.23 g/mol |
| Exact Mass | 493.95 |
| IUPAC Name | disodium;[[2-bromo-4-(1-phenylpropan-2-ylsulfanylmethyl)phenyl]-difluoromethyl]-dioxido-oxo-λ5-phosphane |
| SMILES | CC(Cc1ccccc1)SCc1ccc(C(F)(F)P(=O)([O-])[O-])c(Br)c1.[Na+].[Na+] |
| InChI | InChI=1S/C17H18BrF2O3PS.2Na/c1-12(9-13-5-3-2-4-6-13)25-11-14-7-8-15(16(18)10-14)17(19,20)24(21,22)23;;/h2-8,10,12H,9,11H2,1H3,(H2,21,22,23);;/q;2*+1/p-2 |
| InChIKey | YECZVZXJQXQCSB-UHFFFAOYSA-L |
| XLogP | -1.72 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.23 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|