C10H11BrF2NO5P — CID 11667898
2-amino-3-[3-bromo-4-[difluoro(phosphono)methyl]phenyl]propanoic acid (PubChem CID 11667898) has the molecular formula C10H11BrF2NO5P and a molecular weight of 374.07 g/mol. Its IUPAC name is 2-amino-3-[3-bromo-4-[difluoro(phosphono)methyl]phenyl]propanoic acid.
| Compound Name | 2-amino-3-[3-bromo-4-[difluoro(phosphono)methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 11667898 |
| Molecular Formula | C10H11BrF2NO5P |
| Molecular Weight | 374.07 g/mol |
| Exact Mass | 372.95 |
| IUPAC Name | 2-amino-3-[3-bromo-4-[difluoro(phosphono)methyl]phenyl]propanoic acid |
| SMILES | NC(Cc1ccc(C(F)(F)P(=O)(O)O)c(Br)c1)C(=O)O |
| InChI | InChI=1S/C10H11BrF2NO5P/c11-7-3-5(4-8(14)9(15)16)1-2-6(7)10(12,13)20(17,18)19/h1-3,8H,4,14H2,(H,15,16)(H2,17,18,19) |
| InChIKey | PAMIIKPHKFOTMA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.07 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|