C11H15FNO5P — CID 57039581
(2S)-2-amino-3-[3-(1-fluoro-1-phosphonoethyl)phenyl]propanoic acid (PubChem CID 57039581) has the molecular formula C11H15FNO5P and a molecular weight of 291.21 g/mol. Its IUPAC name is (2S)-2-amino-3-[3-(1-fluoro-1-phosphonoethyl)phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[3-(1-fluoro-1-phosphonoethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 57039581 |
| Molecular Formula | C11H15FNO5P |
| Molecular Weight | 291.21 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | (2S)-2-amino-3-[3-(1-fluoro-1-phosphonoethyl)phenyl]propanoic acid |
| SMILES | CC(F)(c1cccc(C[C@H](N)C(=O)O)c1)P(=O)(O)O |
| InChI | InChI=1S/C11H15FNO5P/c1-11(12,19(16,17)18)8-4-2-3-7(5-8)6-9(13)10(14)15/h2-5,9H,6,13H2,1H3,(H,14,15)(H2,16,17,18)/t9-,11?/m0/s1 |
| InChIKey | GVHQPEBVXRBZLK-FTNKSUMCSA-N |
| XLogP | 0.96 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.21 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|