C17H20NO5P — CID 57029804
(2S)-2-amino-3-[3-(1-phenyl-1-phosphonoethyl)phenyl]propanoic acid (PubChem CID 57029804) has the molecular formula C17H20NO5P and a molecular weight of 349.32 g/mol. Its IUPAC name is (2S)-2-amino-3-[3-(1-phenyl-1-phosphonoethyl)phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[3-(1-phenyl-1-phosphonoethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 57029804 |
| Molecular Formula | C17H20NO5P |
| Molecular Weight | 349.32 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | (2S)-2-amino-3-[3-(1-phenyl-1-phosphonoethyl)phenyl]propanoic acid |
| SMILES | CC(c1ccccc1)(c1cccc(C[C@H](N)C(=O)O)c1)P(=O)(O)O |
| InChI | InChI=1S/C17H20NO5P/c1-17(24(21,22)23,13-7-3-2-4-8-13)14-9-5-6-12(10-14)11-15(18)16(19)20/h2-10,15H,11,18H2,1H3,(H,19,20)(H2,21,22,23)/t15-,17?/m0/s1 |
| InChIKey | QSFVOOCUFAWLIR-MYJWUSKBSA-N |
| XLogP | 2.08 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|