C18H18BrF2O3PS — CID 18342275
[[2-bromo-4-[1-[(E)-3-phenylprop-2-enyl]sulfanylethyl]phenyl]-difluoromethyl]phosphonic acid (PubChem CID 18342275) has the molecular formula C18H18BrF2O3PS and a molecular weight of 463.28 g/mol. Its IUPAC name is [[2-bromo-4-[1-[(E)-3-phenylprop-2-enyl]sulfanylethyl]phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[2-bromo-4-[1-[(E)-3-phenylprop-2-enyl]sulfanylethyl]phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 18342275 |
| Molecular Formula | C18H18BrF2O3PS |
| Molecular Weight | 463.28 g/mol |
| Exact Mass | 461.99 |
| IUPAC Name | [[2-bromo-4-[1-[(E)-3-phenylprop-2-enyl]sulfanylethyl]phenyl]-difluoromethyl]phosphonic acid |
| SMILES | CC(SC/C=C/c1ccccc1)c1ccc(C(F)(F)P(=O)(O)O)c(Br)c1 |
| InChI | InChI=1S/C18H18BrF2O3PS/c1-13(26-11-5-8-14-6-3-2-4-7-14)15-9-10-16(17(19)12-15)18(20,21)25(22,23)24/h2-10,12-13H,11H2,1H3,(H2,22,23,24)/b8-5+ |
| InChIKey | PGFQQRWSYHQARM-VMPITWQZSA-N |
| XLogP | 6.18 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.28 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|