C15H13BrF2NO5PS — CID 18342310
[[2-bromo-4-[(3-nitrophenyl)methylsulfanylmethyl]phenyl]-difluoromethyl]phosphonic acid (PubChem CID 18342310) has the molecular formula C15H13BrF2NO5PS and a molecular weight of 468.21 g/mol. Its IUPAC name is [[2-bromo-4-[(3-nitrophenyl)methylsulfanylmethyl]phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[2-bromo-4-[(3-nitrophenyl)methylsulfanylmethyl]phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 18342310 |
| Molecular Formula | C15H13BrF2NO5PS |
| Molecular Weight | 468.21 g/mol |
| Exact Mass | 466.94 |
| IUPAC Name | [[2-bromo-4-[(3-nitrophenyl)methylsulfanylmethyl]phenyl]-difluoromethyl]phosphonic acid |
| SMILES | O=[N+]([O-])c1cccc(CSCc2ccc(C(F)(F)P(=O)(O)O)c(Br)c2)c1 |
| InChI | InChI=1S/C15H13BrF2NO5PS/c16-14-7-11(4-5-13(14)15(17,18)25(22,23)24)9-26-8-10-2-1-3-12(6-10)19(20)21/h1-7H,8-9H2,(H2,22,23,24) |
| InChIKey | DXUXEYJQTNNXTL-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.21 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|