C6H4ClN3S — CID 84660344
2-chloro-[1,3]thiazolo[4,5-b]pyridin-6-amine (PubChem CID 84660344) has the molecular formula C6H4ClN3S and a molecular weight of 185.64 g/mol. Its IUPAC name is 2-chloro-[1,3]thiazolo[4,5-b]pyridin-6-amine.
| Compound Name | 2-chloro-[1,3]thiazolo[4,5-b]pyridin-6-amine |
|---|---|
| PubChem CID | 84660344 |
| Molecular Formula | C6H4ClN3S |
| Molecular Weight | 185.64 g/mol |
| Exact Mass | 184.98 |
| IUPAC Name | 2-chloro-[1,3]thiazolo[4,5-b]pyridin-6-amine |
| SMILES | Nc1cnc2nc(Cl)sc2c1 |
| InChI | InChI=1S/C6H4ClN3S/c7-6-10-5-4(11-6)1-3(8)2-9-5/h1-2H,8H2 |
| InChIKey | UQWFSUVMUDJHIQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.64 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |