C12H8ClN3S — CID 66202869
2-(5-chloro-2-pyridinyl)-1,3-benzothiazol-6-amine (PubChem CID 66202869) has the molecular formula C12H8ClN3S and a molecular weight of 261.74 g/mol. Its IUPAC name is 2-(5-chloro-2-pyridinyl)-1,3-benzothiazol-6-amine.
| Compound Name | 2-(5-chloro-2-pyridinyl)-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 66202869 |
| Molecular Formula | C12H8ClN3S |
| Molecular Weight | 261.74 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | 2-(5-chloro-2-pyridinyl)-1,3-benzothiazol-6-amine |
| SMILES | Nc1ccc2nc(-c3ccc(Cl)cn3)sc2c1 |
| InChI | InChI=1S/C12H8ClN3S/c13-7-1-3-10(15-6-7)12-16-9-4-2-8(14)5-11(9)17-12/h1-6H,14H2 |
| InChIKey | VEXABAPNMHQQEK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.74 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|