C17H13FN6S — CID 146253159
2-[4-fluoro-6-[2-(methylamino)pyrimidin-5-yl]-3-pyridinyl]-1,3-benzothiazol-6-amine (PubChem CID 146253159) has the molecular formula C17H13FN6S and a molecular weight of 352.40 g/mol. Its IUPAC name is 2-[4-fluoro-6-[2-(methylamino)pyrimidin-5-yl]-3-pyridinyl]-1,3-benzothiazol-6-amine.
| Compound Name | 2-[4-fluoro-6-[2-(methylamino)pyrimidin-5-yl]-3-pyridinyl]-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 146253159 |
| Molecular Formula | C17H13FN6S |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 2-[4-fluoro-6-[2-(methylamino)pyrimidin-5-yl]-3-pyridinyl]-1,3-benzothiazol-6-amine |
| SMILES | CNc1ncc(-c2cc(F)c(-c3nc4ccc(N)cc4s3)cn2)cn1 |
| InChI | InChI=1S/C17H13FN6S/c1-20-17-22-6-9(7-23-17)14-5-12(18)11(8-21-14)16-24-13-3-2-10(19)4-15(13)25-16/h2-8H,19H2,1H3,(H,20,22,23) |
| InChIKey | UTQXAMHRKXILBX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|