C13H7F3N2S — CID 66202280
2-(2,4,6-trifluorophenyl)-1,3-benzothiazol-6-amine (PubChem CID 66202280) has the molecular formula C13H7F3N2S and a molecular weight of 280.27 g/mol. Its IUPAC name is 2-(2,4,6-trifluorophenyl)-1,3-benzothiazol-6-amine.
| Compound Name | 2-(2,4,6-trifluorophenyl)-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 66202280 |
| Molecular Formula | C13H7F3N2S |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 2-(2,4,6-trifluorophenyl)-1,3-benzothiazol-6-amine |
| SMILES | Nc1ccc2nc(-c3c(F)cc(F)cc3F)sc2c1 |
| InChI | InChI=1S/C13H7F3N2S/c14-6-3-8(15)12(9(16)4-6)13-18-10-2-1-7(17)5-11(10)19-13/h1-5H,17H2 |
| InChIKey | UALMZILYABUCOI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|