C24H36S4 — CID 161142248
2,5-bis(5-methylthiophen-2-yl)thieno[3,2-b]thiophene;ethane (PubChem CID 161142248) has the molecular formula C24H36S4 and a molecular weight of 452.82 g/mol. Its IUPAC name is 2,5-bis(5-methylthiophen-2-yl)thieno[3,2-b]thiophene;ethane.
| Compound Name | 2,5-bis(5-methylthiophen-2-yl)thieno[3,2-b]thiophene;ethane |
|---|---|
| PubChem CID | 161142248 |
| Molecular Formula | C24H36S4 |
| Molecular Weight | 452.82 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 2,5-bis(5-methylthiophen-2-yl)thieno[3,2-b]thiophene;ethane |
| SMILES | CC.CC.CC.CC.Cc1ccc(-c2cc3sc(-c4ccc(C)s4)cc3s2)s1 |
| InChI | InChI=1S/C16H12S4.4C2H6/c1-9-3-5-11(17-9)13-7-15-16(19-13)8-14(20-15)12-6-4-10(2)18-12;4*1-2/h3-8H,1-2H3;4*1-2H3 |
| InChIKey | UNPGMXUQUUFJKN-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.82 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |