C22H16N2S4 — CID 22960139
2,5-bis[5-(5-methylthiophen-2-yl)thiophen-2-yl]pyrazine (PubChem CID 22960139) has the molecular formula C22H16N2S4 and a molecular weight of 436.65 g/mol. Its IUPAC name is 2,5-bis[5-(5-methylthiophen-2-yl)thiophen-2-yl]pyrazine.
| Compound Name | 2,5-bis[5-(5-methylthiophen-2-yl)thiophen-2-yl]pyrazine |
|---|---|
| PubChem CID | 22960139 |
| Molecular Formula | C22H16N2S4 |
| Molecular Weight | 436.65 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | 2,5-bis[5-(5-methylthiophen-2-yl)thiophen-2-yl]pyrazine |
| SMILES | Cc1ccc(-c2ccc(-c3cnc(-c4ccc(-c5ccc(C)s5)s4)cn3)s2)s1 |
| InChI | InChI=1S/C22H16N2S4/c1-13-3-5-19(25-13)21-9-7-17(27-21)15-11-24-16(12-23-15)18-8-10-22(28-18)20-6-4-14(2)26-20/h3-12H,1-2H3 |
| InChIKey | GZLICFJVBWAJPN-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.65 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |