C14H10O2S3 — CID 135215247
5-[5-(5-methylthiophen-2-yl)thiophen-2-yl]thiophene-2-carboxylic acid (PubChem CID 135215247) has the molecular formula C14H10O2S3 and a molecular weight of 306.43 g/mol. Its IUPAC name is 5-[5-(5-methylthiophen-2-yl)thiophen-2-yl]thiophene-2-carboxylic acid.
| Compound Name | 5-[5-(5-methylthiophen-2-yl)thiophen-2-yl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 135215247 |
| Molecular Formula | C14H10O2S3 |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | 5-[5-(5-methylthiophen-2-yl)thiophen-2-yl]thiophene-2-carboxylic acid |
| SMILES | Cc1ccc(-c2ccc(-c3ccc(C(=O)O)s3)s2)s1 |
| InChI | InChI=1S/C14H10O2S3/c1-8-2-3-9(17-8)10-4-5-11(18-10)12-6-7-13(19-12)14(15)16/h2-7H,1H3,(H,15,16) |
| InChIKey | ITNNKXAPAMAMIO-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |