C19H16O4S2 — CID 141257769
5-[5-(4-carboxy-3-ethyl-2-methylphenyl)thiophen-2-yl]thiophene-2-carboxylic acid (PubChem CID 141257769) has the molecular formula C19H16O4S2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 5-[5-(4-carboxy-3-ethyl-2-methylphenyl)thiophen-2-yl]thiophene-2-carboxylic acid.
| Compound Name | 5-[5-(4-carboxy-3-ethyl-2-methylphenyl)thiophen-2-yl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 141257769 |
| Molecular Formula | C19H16O4S2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 5-[5-(4-carboxy-3-ethyl-2-methylphenyl)thiophen-2-yl]thiophene-2-carboxylic acid |
| SMILES | CCc1c(C(=O)O)ccc(-c2ccc(-c3ccc(C(=O)O)s3)s2)c1C |
| InChI | InChI=1S/C19H16O4S2/c1-3-11-10(2)12(4-5-13(11)18(20)21)14-6-7-15(24-14)16-8-9-17(25-16)19(22)23/h4-9H,3H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | VFSPQANBBGQQIW-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |