C19H16O3S2 — CID 141257926
5-[5-(2-ethyl-4-formyl-3-methylphenyl)thiophen-2-yl]thiophene-2-carboxylic acid (PubChem CID 141257926) has the molecular formula C19H16O3S2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 5-[5-(2-ethyl-4-formyl-3-methylphenyl)thiophen-2-yl]thiophene-2-carboxylic acid.
| Compound Name | 5-[5-(2-ethyl-4-formyl-3-methylphenyl)thiophen-2-yl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 141257926 |
| Molecular Formula | C19H16O3S2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 5-[5-(2-ethyl-4-formyl-3-methylphenyl)thiophen-2-yl]thiophene-2-carboxylic acid |
| SMILES | CCc1c(-c2ccc(-c3ccc(C(=O)O)s3)s2)ccc(C=O)c1C |
| InChI | InChI=1S/C19H16O3S2/c1-3-13-11(2)12(10-20)4-5-14(13)15-6-7-16(23-15)17-8-9-18(24-17)19(21)22/h4-10H,3H2,1-2H3,(H,21,22) |
| InChIKey | FBUOCHIKYWWNRK-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|