About 5-[5-(3,5-diethyl-4-formylphenyl)thiophen-2-yl]thiophene-2-carboxylic acid
5-[5-(3,5-diethyl-4-formylphenyl)thiophen-2-yl]thiophene-2-carboxylic acid (PubChem CID 141257790) has the molecular formula C20H18O3S2
and a molecular weight of 370.50 g/mol. Its IUPAC name is 5-[5-(3,5-diethyl-4-formylphenyl)thiophen-2-yl]thiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[5-(3,5-diethyl-4-formylphenyl)thiophen-2-yl]thiophene-2-carboxylic acid |
| PubChem CID | 141257790 |
| Molecular Formula | C20H18O3S2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 5-[5-(3,5-diethyl-4-formylphenyl)thiophen-2-yl]thiophene-2-carboxylic acid |
| SMILES | CCc1cc(-c2ccc(-c3ccc(C(=O)O)s3)s2)cc(CC)c1C=O |
| InChI | InChI=1S/C20H18O3S2/c1-3-12-9-14(10-13(4-2)15(12)11-21)16-5-6-17(24-16)18-7-8-19(25-18)20(22)23/h5-11H,3-4H2,1-2H3,(H,22,23) |
| InChIKey | FKUQOENFECYMMY-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-[5-(3,5-diethyl-4-formylphenyl)thiophen-2-yl]thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-(3,5-diethyl-4-formylphenyl)thiophen-2-yl]thiophene-2-carboxylic acid?
The IUPAC name of 5-[5-(3,5-diethyl-4-formylphenyl)thiophen-2-yl]thiophene-2-carboxylic acid (CID 141257790) is 5-[5-(3,5-diethyl-4-formylphenyl)thiophen-2-yl]thiophene-2-carboxylic acid.
What is the SMILES notation for 5-[5-(3,5-diethyl-4-formylphenyl)thiophen-2-yl]thiophene-2-carboxylic acid?
The canonical SMILES for 5-[5-(3,5-diethyl-4-formylphenyl)thiophen-2-yl]thiophene-2-carboxylic acid is CCc1cc(-c2ccc(-c3ccc(C(=O)O)s3)s2)cc(CC)c1C=O.
What is the InChIKey of 5-[5-(3,5-diethyl-4-formylphenyl)thiophen-2-yl]thiophene-2-carboxylic acid?
The InChIKey is FKUQOENFECYMMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18O3S2/c1-3-12-9-14(10-13(4-2)15(12)11-21)16-5-6-17(24-16)18-7-8-19(25-18)20(22)23/h5-11H,3-4H2,1-2H3,(H,22,23).
What are the key properties of 5-[5-(3,5-diethyl-4-formylphenyl)thiophen-2-yl]thiophene-2-carboxylic acid?
5-[5-(3,5-diethyl-4-formylphenyl)thiophen-2-yl]thiophene-2-carboxylic acid has a molecular weight of 370.50 g/mol, XLogP of 5.78, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-(3,5-diethyl-4-formylphenyl)thiophen-2-yl]thiophene-2-carboxylic acid is sourced from PubChem (CID 141257790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).