C20H18O3S2 — CID 141257831
5-[5-(2,3-diethyl-4-formylphenyl)thiophen-2-yl]thiophene-2-carboxylic acid (PubChem CID 141257831) has the molecular formula C20H18O3S2 and a molecular weight of 370.50 g/mol. Its IUPAC name is 5-[5-(2,3-diethyl-4-formylphenyl)thiophen-2-yl]thiophene-2-carboxylic acid.
| Compound Name | 5-[5-(2,3-diethyl-4-formylphenyl)thiophen-2-yl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 141257831 |
| Molecular Formula | C20H18O3S2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 5-[5-(2,3-diethyl-4-formylphenyl)thiophen-2-yl]thiophene-2-carboxylic acid |
| SMILES | CCc1c(C=O)ccc(-c2ccc(-c3ccc(C(=O)O)s3)s2)c1CC |
| InChI | InChI=1S/C20H18O3S2/c1-3-13-12(11-21)5-6-15(14(13)4-2)16-7-8-17(24-16)18-9-10-19(25-18)20(22)23/h5-11H,3-4H2,1-2H3,(H,22,23) |
| InChIKey | IPLHUHVODJBISK-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|