About tert-butyl 2-bromo-2-methylpropanoate;5-methylthiophene-2-carboxylic acid
tert-butyl 2-bromo-2-methylpropanoate;5-methylthiophene-2-carboxylic acid (PubChem CID 161184560) has the molecular formula C14H21BrO4S
and a molecular weight of 365.29 g/mol. Its IUPAC name is tert-butyl 2-bromo-2-methylpropanoate;5-methylthiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | tert-butyl 2-bromo-2-methylpropanoate;5-methylthiophene-2-carboxylic acid |
| PubChem CID | 161184560 |
| Molecular Formula | C14H21BrO4S |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | tert-butyl 2-bromo-2-methylpropanoate;5-methylthiophene-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)C(C)(C)Br.Cc1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C8H15BrO2.C6H6O2S/c1-7(2,3)11-6(10)8(4,5)9;1-4-2-3-5(9-4)6(7)8/h1-5H3;2-3H,1H3,(H,7,8) |
| InChIKey | USXJLJNXZHCBHQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-bromo-2-methylpropanoate;5-methylthiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-bromo-2-methylpropanoate;5-methylthiophene-2-carboxylic acid?
The IUPAC name of tert-butyl 2-bromo-2-methylpropanoate;5-methylthiophene-2-carboxylic acid (CID 161184560) is tert-butyl 2-bromo-2-methylpropanoate;5-methylthiophene-2-carboxylic acid.
What is the SMILES notation for tert-butyl 2-bromo-2-methylpropanoate;5-methylthiophene-2-carboxylic acid?
The canonical SMILES for tert-butyl 2-bromo-2-methylpropanoate;5-methylthiophene-2-carboxylic acid is CC(C)(C)OC(=O)C(C)(C)Br.Cc1ccc(C(=O)O)s1.
What is the InChIKey of tert-butyl 2-bromo-2-methylpropanoate;5-methylthiophene-2-carboxylic acid?
The InChIKey is USXJLJNXZHCBHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15BrO2.C6H6O2S/c1-7(2,3)11-6(10)8(4,5)9;1-4-2-3-5(9-4)6(7)8/h1-5H3;2-3H,1H3,(H,7,8).
What are the key properties of tert-butyl 2-bromo-2-methylpropanoate;5-methylthiophene-2-carboxylic acid?
tert-butyl 2-bromo-2-methylpropanoate;5-methylthiophene-2-carboxylic acid has a molecular weight of 365.29 g/mol, XLogP of 4.26, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-bromo-2-methylpropanoate;5-methylthiophene-2-carboxylic acid is sourced from PubChem (CID 161184560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).