C28H18S4 — CID 144714716
7,16-bis(5-methylthiophen-2-yl)-6,17-dithiapentacyclo[11.7.0.02,10.05,9.014,18]icosa-1(13),2(10),3,5(9),7,11,14(18),15,19-nonaene (PubChem CID 144714716) has the molecular formula C28H18S4 and a molecular weight of 482.72 g/mol. Its IUPAC name is 7,16-bis(5-methylthiophen-2-yl)-6,17-dithiapentacyclo[11.7.0.02,10.05,9.014,18]icosa-1(13),2(10),3,5(9),7,11,14(18),15,19-nonaene.
| Compound Name | 7,16-bis(5-methylthiophen-2-yl)-6,17-dithiapentacyclo[11.7.0.02,10.05,9.014,18]icosa-1(13),2(10),3,5(9),7,11,14(18),15,19-nonaene |
|---|---|
| PubChem CID | 144714716 |
| Molecular Formula | C28H18S4 |
| Molecular Weight | 482.72 g/mol |
| Exact Mass | 482.03 |
| IUPAC Name | 7,16-bis(5-methylthiophen-2-yl)-6,17-dithiapentacyclo[11.7.0.02,10.05,9.014,18]icosa-1(13),2(10),3,5(9),7,11,14(18),15,19-nonaene |
| SMILES | Cc1ccc(-c2cc3c(ccc4c3ccc3c5cc(-c6ccc(C)s6)sc5ccc34)s2)s1 |
| InChI | InChI=1S/C28H18S4/c1-15-3-9-25(29-15)27-13-21-19-5-6-20-18(17(19)7-11-23(21)31-27)8-12-24-22(20)14-28(32-24)26-10-4-16(2)30-26/h3-14H,1-2H3 |
| InChIKey | NOYINFDWUXVCKV-UHFFFAOYSA-N |
| XLogP | 10.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.72 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|