C20H12O2S4 — CID 118422573
2,7-bis(5-methylthiophen-2-yl)thieno[3,2-e][1]benzothiole-4,5-dione (PubChem CID 118422573) has the molecular formula C20H12O2S4 and a molecular weight of 412.58 g/mol. Its IUPAC name is 2,7-bis(5-methylthiophen-2-yl)thieno[3,2-e][1]benzothiole-4,5-dione.
| Compound Name | 2,7-bis(5-methylthiophen-2-yl)thieno[3,2-e][1]benzothiole-4,5-dione |
|---|---|
| PubChem CID | 118422573 |
| Molecular Formula | C20H12O2S4 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 411.97 |
| IUPAC Name | 2,7-bis(5-methylthiophen-2-yl)thieno[3,2-e][1]benzothiole-4,5-dione |
| SMILES | Cc1ccc(-c2cc3c(s2)C(=O)C(=O)c2sc(-c4ccc(C)s4)cc2-3)s1 |
| InChI | InChI=1S/C20H12O2S4/c1-9-3-5-13(23-9)15-7-11-12-8-16(14-6-4-10(2)24-14)26-20(12)18(22)17(21)19(11)25-15/h3-8H,1-2H3 |
| InChIKey | ROQHSAPIXKGLPN-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|