C16H10O2S3 — CID 155694528
3-methyl-1-(5-methylthiophen-2-yl)thieno[3,4-f][2]benzothiole-4,8-dione (PubChem CID 155694528) has the molecular formula C16H10O2S3 and a molecular weight of 330.45 g/mol. Its IUPAC name is 3-methyl-1-(5-methylthiophen-2-yl)thieno[3,4-f][2]benzothiole-4,8-dione.
| Compound Name | 3-methyl-1-(5-methylthiophen-2-yl)thieno[3,4-f][2]benzothiole-4,8-dione |
|---|---|
| PubChem CID | 155694528 |
| Molecular Formula | C16H10O2S3 |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | 3-methyl-1-(5-methylthiophen-2-yl)thieno[3,4-f][2]benzothiole-4,8-dione |
| SMILES | Cc1ccc(-c2sc(C)c3c2C(=O)c2cscc2C3=O)s1 |
| InChI | InChI=1S/C16H10O2S3/c1-7-3-4-11(20-7)16-13-12(8(2)21-16)14(17)9-5-19-6-10(9)15(13)18/h3-6H,1-2H3 |
| InChIKey | CXXDSQFOQVEKNQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|