C17H18CuN2+ — CID 21144970
copper(1+);2,3,4,7,8-pentamethyl-1,10-phenanthroline (PubChem CID 21144970) has the molecular formula C17H18CuN2+ and a molecular weight of 313.89 g/mol. Its IUPAC name is copper(1+);2,3,4,7,8-pentamethyl-1,10-phenanthroline.
| Compound Name | copper(1+);2,3,4,7,8-pentamethyl-1,10-phenanthroline |
|---|---|
| PubChem CID | 21144970 |
| Molecular Formula | C17H18CuN2+ |
| Molecular Weight | 313.89 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | copper(1+);2,3,4,7,8-pentamethyl-1,10-phenanthroline |
| SMILES | Cc1cnc2c(ccc3c(C)c(C)c(C)nc32)c1C.[Cu+] |
| InChI | InChI=1S/C17H18N2.Cu/c1-9-8-18-16-14(10(9)2)6-7-15-12(4)11(3)13(5)19-17(15)16;/h6-8H,1-5H3;/q;+1 |
| InChIKey | JTMNNVOXZVGHNO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.89 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|