C32H32N6 — CID 144711240
2,3-dipyridin-2-ylpyrazine;ethane;3,4,7,8-tetramethyl-1,10-phenanthroline (PubChem CID 144711240) has the molecular formula C32H32N6 and a molecular weight of 500.65 g/mol. Its IUPAC name is 2,3-dipyridin-2-ylpyrazine;ethane;3,4,7,8-tetramethyl-1,10-phenanthroline.
| Compound Name | 2,3-dipyridin-2-ylpyrazine;ethane;3,4,7,8-tetramethyl-1,10-phenanthroline |
|---|---|
| PubChem CID | 144711240 |
| Molecular Formula | C32H32N6 |
| Molecular Weight | 500.65 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | 2,3-dipyridin-2-ylpyrazine;ethane;3,4,7,8-tetramethyl-1,10-phenanthroline |
| SMILES | CC.Cc1cnc2c(ccc3c(C)c(C)cnc32)c1C.c1ccc(-c2nccnc2-c2ccccn2)nc1 |
| InChI | InChI=1S/C16H16N2.C14H10N4.C2H6/c1-9-7-17-15-13(11(9)3)5-6-14-12(4)10(2)8-18-16(14)15;1-3-7-15-11(5-1)13-14(18-10-9-17-13)12-6-2-4-8-16-12;1-2/h5-8H,1-4H3;1-10H;1-2H3 |
| InChIKey | KGCMLAGJPWXYKX-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.65 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|