C18H13N3 — CID 168852602
3-methyl-7-pyridin-2-yl-2,8-phenanthroline (PubChem CID 168852602) has the molecular formula C18H13N3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 3-methyl-7-pyridin-2-yl-2,8-phenanthroline.
| Compound Name | 3-methyl-7-pyridin-2-yl-2,8-phenanthroline |
|---|---|
| PubChem CID | 168852602 |
| Molecular Formula | C18H13N3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 3-methyl-7-pyridin-2-yl-2,8-phenanthroline |
| SMILES | Cc1cc2ccc3c(-c4ccccn4)nccc3c2cn1 |
| InChI | InChI=1S/C18H13N3/c1-12-10-13-5-6-15-14(16(13)11-21-12)7-9-20-18(15)17-4-2-3-8-19-17/h2-11H,1H3 |
| InChIKey | NNMWOPQUFNJJGR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|