C19H14N2 — CID 168852625
7-(3-methylphenyl)-2,8-phenanthroline (PubChem CID 168852625) has the molecular formula C19H14N2 and a molecular weight of 270.34 g/mol. Its IUPAC name is 7-(3-methylphenyl)-2,8-phenanthroline.
| Compound Name | 7-(3-methylphenyl)-2,8-phenanthroline |
|---|---|
| PubChem CID | 168852625 |
| Molecular Formula | C19H14N2 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 7-(3-methylphenyl)-2,8-phenanthroline |
| SMILES | Cc1cccc(-c2nccc3c2ccc2ccncc23)c1 |
| InChI | InChI=1S/C19H14N2/c1-13-3-2-4-15(11-13)19-17-6-5-14-7-9-20-12-18(14)16(17)8-10-21-19/h2-12H,1H3 |
| InChIKey | LIUMCQDYKBWAKO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|