C25H25N — CID 155619475
8-tert-butyl-4-(3,5-dimethylphenyl)benzo[f]isoquinoline (PubChem CID 155619475) has the molecular formula C25H25N and a molecular weight of 339.48 g/mol. Its IUPAC name is 8-tert-butyl-4-(3,5-dimethylphenyl)benzo[f]isoquinoline.
| Compound Name | 8-tert-butyl-4-(3,5-dimethylphenyl)benzo[f]isoquinoline |
|---|---|
| PubChem CID | 155619475 |
| Molecular Formula | C25H25N |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | 8-tert-butyl-4-(3,5-dimethylphenyl)benzo[f]isoquinoline |
| SMILES | Cc1cc(C)cc(-c2nccc3c2ccc2cc(C(C)(C)C)ccc23)c1 |
| InChI | InChI=1S/C25H25N/c1-16-12-17(2)14-19(13-16)24-23-8-6-18-15-20(25(3,4)5)7-9-21(18)22(23)10-11-26-24/h6-15H,1-5H3 |
| InChIKey | ZAWWNBHRVWZMQP-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|