About 4-(3,5-dimethylphenyl)-8-(2,2-dimethylpropyl)benzo[f]isoquinoline
4-(3,5-dimethylphenyl)-8-(2,2-dimethylpropyl)benzo[f]isoquinoline (PubChem CID 156787409) has the molecular formula C26H27N
and a molecular weight of 353.51 g/mol. Its IUPAC name is 4-(3,5-dimethylphenyl)-8-(2,2-dimethylpropyl)benzo[f]isoquinoline.
Molecular Properties
| Compound Name | 4-(3,5-dimethylphenyl)-8-(2,2-dimethylpropyl)benzo[f]isoquinoline |
| PubChem CID | 156787409 |
| Molecular Formula | C26H27N |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 4-(3,5-dimethylphenyl)-8-(2,2-dimethylpropyl)benzo[f]isoquinoline |
| SMILES | Cc1cc(C)cc(-c2nccc3c2ccc2cc(CC(C)(C)C)ccc23)c1 |
| InChI | InChI=1S/C26H27N/c1-17-12-18(2)14-21(13-17)25-24-9-7-20-15-19(16-26(3,4)5)6-8-22(20)23(24)10-11-27-25/h6-15H,16H2,1-5H3 |
| InChIKey | IEFZNHSLKGIIMJ-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,5-dimethylphenyl)-8-(2,2-dimethylpropyl)benzo[f]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dimethylphenyl)-8-(2,2-dimethylpropyl)benzo[f]isoquinoline?
The IUPAC name of 4-(3,5-dimethylphenyl)-8-(2,2-dimethylpropyl)benzo[f]isoquinoline (CID 156787409) is 4-(3,5-dimethylphenyl)-8-(2,2-dimethylpropyl)benzo[f]isoquinoline.
What is the SMILES notation for 4-(3,5-dimethylphenyl)-8-(2,2-dimethylpropyl)benzo[f]isoquinoline?
The canonical SMILES for 4-(3,5-dimethylphenyl)-8-(2,2-dimethylpropyl)benzo[f]isoquinoline is Cc1cc(C)cc(-c2nccc3c2ccc2cc(CC(C)(C)C)ccc23)c1.
What is the InChIKey of 4-(3,5-dimethylphenyl)-8-(2,2-dimethylpropyl)benzo[f]isoquinoline?
The InChIKey is IEFZNHSLKGIIMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27N/c1-17-12-18(2)14-21(13-17)25-24-9-7-20-15-19(16-26(3,4)5)6-8-22(20)23(24)10-11-27-25/h6-15H,16H2,1-5H3.
What are the key properties of 4-(3,5-dimethylphenyl)-8-(2,2-dimethylpropyl)benzo[f]isoquinoline?
4-(3,5-dimethylphenyl)-8-(2,2-dimethylpropyl)benzo[f]isoquinoline has a molecular weight of 353.51 g/mol, XLogP of 7.26, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dimethylphenyl)-8-(2,2-dimethylpropyl)benzo[f]isoquinoline is sourced from PubChem (CID 156787409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).