C31H25NO — CID 171734748
1-[11,11-dimethyl-1-(3-methylphenyl)fluoreno[2,1-f]isoquinolin-9-yl]ethanone (PubChem CID 171734748) has the molecular formula C31H25NO and a molecular weight of 427.55 g/mol. Its IUPAC name is 1-[11,11-dimethyl-1-(3-methylphenyl)fluoreno[2,1-f]isoquinolin-9-yl]ethanone.
| Compound Name | 1-[11,11-dimethyl-1-(3-methylphenyl)fluoreno[2,1-f]isoquinolin-9-yl]ethanone |
|---|---|
| PubChem CID | 171734748 |
| Molecular Formula | C31H25NO |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 1-[11,11-dimethyl-1-(3-methylphenyl)fluoreno[2,1-f]isoquinolin-9-yl]ethanone |
| SMILES | CC(=O)c1ccc2c(c1)C(C)(C)c1c-2ccc2c1ccc1c(-c3cccc(C)c3)nccc12 |
| InChI | InChI=1S/C31H25NO/c1-18-6-5-7-21(16-18)30-27-13-12-25-22(23(27)14-15-32-30)10-11-26-24-9-8-20(19(2)33)17-28(24)31(3,4)29(25)26/h5-17H,1-4H3 |
| InChIKey | NHTOEQHKFVCNKL-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|