C30H22F3N — CID 171734659
11,11-dimethyl-1-(3-methylphenyl)-9-(trifluoromethyl)fluoreno[2,1-f]isoquinoline (PubChem CID 171734659) has the molecular formula C30H22F3N and a molecular weight of 453.51 g/mol. Its IUPAC name is 11,11-dimethyl-1-(3-methylphenyl)-9-(trifluoromethyl)fluoreno[2,1-f]isoquinoline.
| Compound Name | 11,11-dimethyl-1-(3-methylphenyl)-9-(trifluoromethyl)fluoreno[2,1-f]isoquinoline |
|---|---|
| PubChem CID | 171734659 |
| Molecular Formula | C30H22F3N |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 11,11-dimethyl-1-(3-methylphenyl)-9-(trifluoromethyl)fluoreno[2,1-f]isoquinoline |
| SMILES | Cc1cccc(-c2nccc3c2ccc2c4c(ccc23)-c2ccc(C(F)(F)F)cc2C4(C)C)c1 |
| InChI | InChI=1S/C30H22F3N/c1-17-5-4-6-18(15-17)28-25-12-11-23-20(21(25)13-14-34-28)9-10-24-22-8-7-19(30(31,32)33)16-26(22)29(2,3)27(23)24/h4-16H,1-3H3 |
| InChIKey | ABQQDVQGLLTZTF-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|