C36H32IrNO2- — CID 171734635
(Z)-4-hydroxypent-3-en-2-one;iridium;14,14,22,22-tetramethyl-6-phenyl-7-azahexacyclo[17.2.1.02,11.05,10.013,21.015,20]docosa-1,3,5(10),6,8,11,13(21),15(20),16,18-decaene (PubChem CID 171734635) has the molecular formula C36H32IrNO2- and a molecular weight of 702.87 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;14,14,22,22-tetramethyl-6-phenyl-7-azahexacyclo[17.2.1.02,11.05,10.013,21.015,20]docosa-1,3,5(10),6,8,11,13(21),15(20),16,18-decaene.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;14,14,22,22-tetramethyl-6-phenyl-7-azahexacyclo[17.2.1.02,11.05,10.013,21.015,20]docosa-1,3,5(10),6,8,11,13(21),15(20),16,18-decaene |
|---|---|
| PubChem CID | 171734635 |
| Molecular Formula | C36H32IrNO2- |
| Molecular Weight | 702.87 g/mol |
| Exact Mass | 703.21 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;14,14,22,22-tetramethyl-6-phenyl-7-azahexacyclo[17.2.1.02,11.05,10.013,21.015,20]docosa-1,3,5(10),6,8,11,13(21),15(20),16,18-decaene |
| SMILES | CC(=O)/C=C(/C)O.CC1(C)c2cccc3c2-c2c1cc1c(ccc4c(-c5[c-]cccc5)nccc41)c2C3(C)C.[Ir] |
| InChI | InChI=1S/C31H24N.C5H8O2.Ir/c1-30(2)23-11-8-12-24-26(23)27-25(30)17-22-19-15-16-32-29(18-9-6-5-7-10-18)21(19)14-13-20(22)28(27)31(24,3)4;1-4(6)3-5(2)7;/h5-9,11-17H,1-4H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | JMKPGRRVBLWIGS-LWFKIUJUSA-N |
| XLogP | 8.84 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.87 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|