C28H28IrNO3- — CID 170679024
4,7-dimethyl-15-phenyl-17-oxa-14-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12,14-hexaene;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 170679024) has the molecular formula C28H28IrNO3- and a molecular weight of 618.75 g/mol. Its IUPAC name is 4,7-dimethyl-15-phenyl-17-oxa-14-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12,14-hexaene;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 4,7-dimethyl-15-phenyl-17-oxa-14-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12,14-hexaene;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 170679024 |
| Molecular Formula | C28H28IrNO3- |
| Molecular Weight | 618.75 g/mol |
| Exact Mass | 619.17 |
| IUPAC Name | 4,7-dimethyl-15-phenyl-17-oxa-14-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12,14-hexaene;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.CC1CCC(C)c2cc3c(cc21)oc1c(-c2[c-]cccc2)nccc13.[Ir] |
| InChI | InChI=1S/C23H20NO.C5H8O2.Ir/c1-14-8-9-15(2)19-13-21-20(12-18(14)19)17-10-11-24-22(23(17)25-21)16-6-4-3-5-7-16;1-4(6)3-5(2)7;/h3-6,10-15H,8-9H2,1-2H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | VPJOVLRKGLNANE-LWFKIUJUSA-N |
| XLogP | 7.48 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.75 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|