C27H26IrNO3- — CID 170679201
(Z)-4-hydroxypent-3-en-2-one;iridium;9-methyl-15-phenyl-17-oxa-14-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11(16),12,14-hexaene (PubChem CID 170679201) has the molecular formula C27H26IrNO3- and a molecular weight of 604.73 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;9-methyl-15-phenyl-17-oxa-14-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11(16),12,14-hexaene.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;9-methyl-15-phenyl-17-oxa-14-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11(16),12,14-hexaene |
|---|---|
| PubChem CID | 170679201 |
| Molecular Formula | C27H26IrNO3- |
| Molecular Weight | 604.73 g/mol |
| Exact Mass | 605.15 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;9-methyl-15-phenyl-17-oxa-14-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11(16),12,14-hexaene |
| SMILES | CC(=O)/C=C(/C)O.Cc1c2c(cc3oc4c(-c5[c-]cccc5)nccc4c13)CCCC2.[Ir] |
| InChI | InChI=1S/C22H18NO.C5H8O2.Ir/c1-14-17-10-6-5-9-16(17)13-19-20(14)18-11-12-23-21(22(18)24-19)15-7-3-2-4-8-15;1-4(6)3-5(2)7;/h2-4,7,11-13H,5-6,9-10H2,1H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | BRZICNSHRNYUIS-LWFKIUJUSA-N |
| XLogP | 6.67 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.73 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|