C33H38IrNO3- — CID 170679098
15-(3,4-dimethylbenzene-6-id-1-yl)-9-(2,2-dimethylpropyl)-17-oxa-14-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11(16),12,14-hexaene;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 170679098) has the molecular formula C33H38IrNO3- and a molecular weight of 688.89 g/mol. Its IUPAC name is 15-(3,4-dimethylbenzene-6-id-1-yl)-9-(2,2-dimethylpropyl)-17-oxa-14-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11(16),12,14-hexaene;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 15-(3,4-dimethylbenzene-6-id-1-yl)-9-(2,2-dimethylpropyl)-17-oxa-14-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11(16),12,14-hexaene;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 170679098 |
| Molecular Formula | C33H38IrNO3- |
| Molecular Weight | 688.89 g/mol |
| Exact Mass | 689.25 |
| IUPAC Name | 15-(3,4-dimethylbenzene-6-id-1-yl)-9-(2,2-dimethylpropyl)-17-oxa-14-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11(16),12,14-hexaene;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.Cc1c[c-]c(-c2nccc3c2oc2cc4c(c(CC(C)(C)C)c23)CCCC4)cc1C.[Ir] |
| InChI | InChI=1S/C28H30NO.C5H8O2.Ir/c1-17-10-11-20(14-18(17)2)26-27-22(12-13-29-26)25-23(16-28(3,4)5)21-9-7-6-8-19(21)15-24(25)30-27;1-4(6)3-5(2)7;/h10,12-15H,6-9,16H2,1-5H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | YRCZGIFZUYTDOC-LWFKIUJUSA-N |
| XLogP | 8.57 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.89 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|