C33H36GeIrNO3- — CID 166018450
[1-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-[1]benzofuro[2,3-c]pyridin-8-yl]-trimethylgermane;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 166018450) has the molecular formula C33H36GeIrNO3- and a molecular weight of 759.48 g/mol. Its IUPAC name is [1-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-[1]benzofuro[2,3-c]pyridin-8-yl]-trimethylgermane;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | [1-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-[1]benzofuro[2,3-c]pyridin-8-yl]-trimethylgermane;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 166018450 |
| Molecular Formula | C33H36GeIrNO3- |
| Molecular Weight | 759.48 g/mol |
| Exact Mass | 761.15 |
| IUPAC Name | [1-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-[1]benzofuro[2,3-c]pyridin-8-yl]-trimethylgermane;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.CC(C)(C)c1cc(-c2nccc3c2oc2c([Ge](C)(C)C)cccc23)[c-]c2ccccc12.[Ir] |
| InChI | InChI=1S/C28H28GeNO.C5H8O2.Ir/c1-28(2,3)23-17-19(16-18-10-7-8-11-20(18)23)25-27-22(14-15-30-25)21-12-9-13-24(26(21)31-27)29(4,5)6;1-4(6)3-5(2)7;/h7-15,17H,1-6H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | PVMMDIBNOHUCEZ-LWFKIUJUSA-N |
| XLogP | 8.48 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.48 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|