C32H34IrNO3Si- — CID 166018588
(Z)-4-hydroxypent-3-en-2-one;iridium;trimethyl-[1-(4-propan-2-yl-1H-naphthalen-1-id-2-yl)-[1]benzofuro[2,3-c]pyridin-8-yl]silane (PubChem CID 166018588) has the molecular formula C32H34IrNO3Si- and a molecular weight of 700.93 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;trimethyl-[1-(4-propan-2-yl-1H-naphthalen-1-id-2-yl)-[1]benzofuro[2,3-c]pyridin-8-yl]silane.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;trimethyl-[1-(4-propan-2-yl-1H-naphthalen-1-id-2-yl)-[1]benzofuro[2,3-c]pyridin-8-yl]silane |
|---|---|
| PubChem CID | 166018588 |
| Molecular Formula | C32H34IrNO3Si- |
| Molecular Weight | 700.93 g/mol |
| Exact Mass | 701.19 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;trimethyl-[1-(4-propan-2-yl-1H-naphthalen-1-id-2-yl)-[1]benzofuro[2,3-c]pyridin-8-yl]silane |
| SMILES | CC(=O)/C=C(/C)O.CC(C)c1cc(-c2nccc3c2oc2c([Si](C)(C)C)cccc23)[c-]c2ccccc12.[Ir] |
| InChI | InChI=1S/C27H26NOSi.C5H8O2.Ir/c1-17(2)23-16-19(15-18-9-6-7-10-20(18)23)25-27-22(13-14-28-25)21-11-8-12-24(26(21)29-27)30(3,4)5;1-4(6)3-5(2)7;/h6-14,16-17H,1-5H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | HPKKCGNTVNBLAM-LWFKIUJUSA-N |
| XLogP | 8.30 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.93 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|