C38H46IrNO2SSi- — CID 171764287
(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium;trimethyl-[1-(4-propan-2-yl-1H-naphthalen-1-id-2-yl)-[1]benzothiolo[3,2-c]pyridin-7-yl]silane (PubChem CID 171764287) has the molecular formula C38H46IrNO2SSi- and a molecular weight of 801.16 g/mol. Its IUPAC name is (Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium;trimethyl-[1-(4-propan-2-yl-1H-naphthalen-1-id-2-yl)-[1]benzothiolo[3,2-c]pyridin-7-yl]silane.
| Compound Name | (Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium;trimethyl-[1-(4-propan-2-yl-1H-naphthalen-1-id-2-yl)-[1]benzothiolo[3,2-c]pyridin-7-yl]silane |
|---|---|
| PubChem CID | 171764287 |
| Molecular Formula | C38H46IrNO2SSi- |
| Molecular Weight | 801.16 g/mol |
| Exact Mass | 801.27 |
| IUPAC Name | (Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium;trimethyl-[1-(4-propan-2-yl-1H-naphthalen-1-id-2-yl)-[1]benzothiolo[3,2-c]pyridin-7-yl]silane |
| SMILES | CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.CC(C)c1cc(-c2nccc3sc4cc([Si](C)(C)C)ccc4c23)[c-]c2ccccc12.[Ir] |
| InChI | InChI=1S/C27H26NSSi.C11H20O2.Ir/c1-17(2)23-15-19(14-18-8-6-7-9-21(18)23)27-26-22-11-10-20(30(3,4)5)16-25(22)29-24(26)12-13-28-27;1-10(2,3)8(12)7-9(13)11(4,5)6;/h6-13,15-17H,1-5H3;7,12H,1-6H3;/q-1;;/b;8-7-; |
| InChIKey | VVQAILKZRWSGNX-HXIBTQJOSA-N |
| XLogP | 10.83 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.16 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|