About CID 164814840
CID 164814840 (PubChem CID 164814840) has the molecular formula C32H30IrNO2S2-
and a molecular weight of 716.95 g/mol.
Molecular Properties
| Compound Name | CID 164814840 |
| PubChem CID | 164814840 |
| Molecular Formula | C32H30IrNO2S2- |
| Molecular Weight | 716.95 g/mol |
| Exact Mass | 717.14 |
| IUPAC Name | — |
| SMILES | CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.[Ir].[c-]1c2ccccc2cc2sc3cccc4sc5ccnc(c12)c5c34 |
| InChI | InChI=1S/C21H10NS2.C11H20O2.Ir/c1-2-5-13-11-18-14(10-12(13)4-1)21-20-17(8-9-22-21)23-15-6-3-7-16(24-18)19(15)20;1-10(2,3)8(12)7-9(13)11(4,5)6;/h1-9,11H;7,12H,1-6H3;/q-1;;/b;8-7-; |
| InChIKey | GMQHQBRRDMYPER-HXIBTQJOSA-N |
| XLogP | 9.86 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 716.95 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 164814840 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164814840?
The IUPAC name of CID 164814840 (CID 164814840) is not available.
What is the SMILES notation for CID 164814840?
The canonical SMILES for CID 164814840 is CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.[Ir].[c-]1c2ccccc2cc2sc3cccc4sc5ccnc(c12)c5c34.
What is the InChIKey of CID 164814840?
The InChIKey is GMQHQBRRDMYPER-HXIBTQJOSA-N. The full InChI is InChI=1S/C21H10NS2.C11H20O2.Ir/c1-2-5-13-11-18-14(10-12(13)4-1)21-20-17(8-9-22-21)23-15-6-3-7-16(24-18)19(15)20;1-10(2,3)8(12)7-9(13)11(4,5)6;/h1-9,11H;7,12H,1-6H3;/q-1;;/b;8-7-;.
What are the key properties of CID 164814840?
CID 164814840 has a molecular weight of 716.95 g/mol, XLogP of 9.86, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164814840 is sourced from PubChem (CID 164814840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).