About CID 176881118
CID 176881118 (PubChem CID 176881118) has the molecular formula C39H37IrN2O2S-
and a molecular weight of 790.02 g/mol.
Molecular Properties
| Compound Name | CID 176881118 |
| PubChem CID | 176881118 |
| Molecular Formula | C39H37IrN2O2S- |
| Molecular Weight | 790.02 g/mol |
| Exact Mass | 790.22 |
| IUPAC Name | — |
| SMILES | CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.Cc1cc2c(ccc3c4ccnc5c4c(cc23)Sc2cc3ccccc3[c-]c2-5)c(C)n1.[Ir] |
| InChI | InChI=1S/C28H17N2S.C11H20O2.Ir/c1-15-11-22-19(16(2)30-15)7-8-20-21-9-10-29-28-24-12-17-5-3-4-6-18(17)13-25(24)31-26(27(21)28)14-23(20)22;1-10(2,3)8(12)7-9(13)11(4,5)6;/h3-11,13-14H,1-2H3;7,12H,1-6H3;/q-1;;/b;8-7-; |
| InChIKey | JDTODGLSXKFRIW-HXIBTQJOSA-N |
| XLogP | 10.73 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 790.02 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 176881118 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176881118?
The IUPAC name of CID 176881118 (CID 176881118) is not available.
What is the SMILES notation for CID 176881118?
The canonical SMILES for CID 176881118 is CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.Cc1cc2c(ccc3c4ccnc5c4c(cc23)Sc2cc3ccccc3[c-]c2-5)c(C)n1.[Ir].
What is the InChIKey of CID 176881118?
The InChIKey is JDTODGLSXKFRIW-HXIBTQJOSA-N. The full InChI is InChI=1S/C28H17N2S.C11H20O2.Ir/c1-15-11-22-19(16(2)30-15)7-8-20-21-9-10-29-28-24-12-17-5-3-4-6-18(17)13-25(24)31-26(27(21)28)14-23(20)22;1-10(2,3)8(12)7-9(13)11(4,5)6;/h3-11,13-14H,1-2H3;7,12H,1-6H3;/q-1;;/b;8-7-;.
What are the key properties of CID 176881118?
CID 176881118 has a molecular weight of 790.02 g/mol, XLogP of 10.73, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176881118 is sourced from PubChem (CID 176881118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).