About CID 176880876
CID 176880876 (PubChem CID 176880876) has the molecular formula C44H37F2IrN2O2-
and a molecular weight of 856.01 g/mol.
Molecular Properties
| Compound Name | CID 176880876 |
| PubChem CID | 176880876 |
| Molecular Formula | C44H37F2IrN2O2- |
| Molecular Weight | 856.01 g/mol |
| Exact Mass | 856.25 |
| IUPAC Name | — |
| SMILES | CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.Fc1cc2ccc3c4ccnc5c4c(cc3c2cc1F)N(c1ccccc1)c1cc2ccccc2[c-]c1-5.[Ir] |
| InChI | InChI=1S/C33H17F2N2.C11H20O2.Ir/c34-28-15-21-10-11-23-24-12-13-36-33-27-14-19-6-4-5-7-20(19)16-30(27)37(22-8-2-1-3-9-22)31(32(24)33)18-26(23)25(21)17-29(28)35;1-10(2,3)8(12)7-9(13)11(4,5)6;/h1-13,15-18H;7,12H,1-6H3;/q-1;;/b;8-7-; |
| InChIKey | QGHQGJGUKNJLBS-HXIBTQJOSA-N |
| XLogP | 12.31 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 51 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 856.01 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 176880876 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176880876?
The IUPAC name of CID 176880876 (CID 176880876) is not available.
What is the SMILES notation for CID 176880876?
The canonical SMILES for CID 176880876 is CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.Fc1cc2ccc3c4ccnc5c4c(cc3c2cc1F)N(c1ccccc1)c1cc2ccccc2[c-]c1-5.[Ir].
What is the InChIKey of CID 176880876?
The InChIKey is QGHQGJGUKNJLBS-HXIBTQJOSA-N. The full InChI is InChI=1S/C33H17F2N2.C11H20O2.Ir/c34-28-15-21-10-11-23-24-12-13-36-33-27-14-19-6-4-5-7-20(19)16-30(27)37(22-8-2-1-3-9-22)31(32(24)33)18-26(23)25(21)17-29(28)35;1-10(2,3)8(12)7-9(13)11(4,5)6;/h1-13,15-18H;7,12H,1-6H3;/q-1;;/b;8-7-;.
What are the key properties of CID 176880876?
CID 176880876 has a molecular weight of 856.01 g/mol, XLogP of 12.31, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176880876 is sourced from PubChem (CID 176880876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).