About CID 165170279
CID 165170279 (PubChem CID 165170279) has the molecular formula C30H30IrNO4S-
and a molecular weight of 692.86 g/mol.
Molecular Properties
| Compound Name | CID 165170279 |
| PubChem CID | 165170279 |
| Molecular Formula | C30H30IrNO4S- |
| Molecular Weight | 692.86 g/mol |
| Exact Mass | 693.15 |
| IUPAC Name | — |
| SMILES | CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.O=S1(=O)c2ccc[c-]c2-c2nccc3c2c1cc1ccccc13.[Ir] |
| InChI | InChI=1S/C19H10NO2S.C11H20O2.Ir/c21-23(22)16-8-4-3-7-15(16)19-18-14(9-10-20-19)13-6-2-1-5-12(13)11-17(18)23;1-10(2,3)8(12)7-9(13)11(4,5)6;/h1-6,8-11H;7,12H,1-6H3;/q-1;;/b;8-7-; |
| InChIKey | XMSGWFNLHFEXKX-HXIBTQJOSA-N |
| XLogP | 7.09 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 692.86 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 165170279 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 165170279?
The IUPAC name of CID 165170279 (CID 165170279) is not available.
What is the SMILES notation for CID 165170279?
The canonical SMILES for CID 165170279 is CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.O=S1(=O)c2ccc[c-]c2-c2nccc3c2c1cc1ccccc13.[Ir].
What is the InChIKey of CID 165170279?
The InChIKey is XMSGWFNLHFEXKX-HXIBTQJOSA-N. The full InChI is InChI=1S/C19H10NO2S.C11H20O2.Ir/c21-23(22)16-8-4-3-7-15(16)19-18-14(9-10-20-19)13-6-2-1-5-12(13)11-17(18)23;1-10(2,3)8(12)7-9(13)11(4,5)6;/h1-6,8-11H;7,12H,1-6H3;/q-1;;/b;8-7-;.
What are the key properties of CID 165170279?
CID 165170279 has a molecular weight of 692.86 g/mol, XLogP of 7.09, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 165170279 is sourced from PubChem (CID 165170279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).