C39H46IrNO2- — CID 162503637
(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium;6,6,8,8-tetramethyl-7-phenyl-1-phenyl-7H-cyclopenta[g]isoquinoline (PubChem CID 162503637) has the molecular formula C39H46IrNO2- and a molecular weight of 753.02 g/mol. Its IUPAC name is (Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium;6,6,8,8-tetramethyl-7-phenyl-1-phenyl-7H-cyclopenta[g]isoquinoline.
| Compound Name | (Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium;6,6,8,8-tetramethyl-7-phenyl-1-phenyl-7H-cyclopenta[g]isoquinoline |
|---|---|
| PubChem CID | 162503637 |
| Molecular Formula | C39H46IrNO2- |
| Molecular Weight | 753.02 g/mol |
| Exact Mass | 753.32 |
| IUPAC Name | (Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium;6,6,8,8-tetramethyl-7-phenyl-1-phenyl-7H-cyclopenta[g]isoquinoline |
| SMILES | CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.CC1(C)c2cc3ccnc(-c4[c-]cccc4)c3cc2C(C)(C)C1c1ccccc1.[Ir] |
| InChI | InChI=1S/C28H26N.C11H20O2.Ir/c1-27(2)23-17-21-15-16-29-25(19-11-7-5-8-12-19)22(21)18-24(23)28(3,4)26(27)20-13-9-6-10-14-20;1-10(2,3)8(12)7-9(13)11(4,5)6;/h5-11,13-18,26H,1-4H3;7,12H,1-6H3;/q-1;;/b;8-7-; |
| InChIKey | LJPQLDBJGAIQKP-HXIBTQJOSA-N |
| XLogP | 10.14 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.02 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|