C34H34IrNO2S- — CID 170678607
(Z)-4-hydroxypent-3-en-2-one;iridium;17,17,18,18-tetramethyl-5-phenyl-12-thia-6-azapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),3,5,7,9,14,20-octaene (PubChem CID 170678607) has the molecular formula C34H34IrNO2S- and a molecular weight of 712.94 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;17,17,18,18-tetramethyl-5-phenyl-12-thia-6-azapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),3,5,7,9,14,20-octaene.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;17,17,18,18-tetramethyl-5-phenyl-12-thia-6-azapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),3,5,7,9,14,20-octaene |
|---|---|
| PubChem CID | 170678607 |
| Molecular Formula | C34H34IrNO2S- |
| Molecular Weight | 712.94 g/mol |
| Exact Mass | 713.19 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;17,17,18,18-tetramethyl-5-phenyl-12-thia-6-azapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),3,5,7,9,14,20-octaene |
| SMILES | CC(=O)/C=C(/C)O.CC1(C)Cc2cc3sc4cc5ccnc(-c6[c-]cccc6)c5cc4c3cc2CC1(C)C.[Ir] |
| InChI | InChI=1S/C29H26NS.C5H8O2.Ir/c1-28(2)16-20-12-23-24-15-22-19(10-11-30-27(22)18-8-6-5-7-9-18)13-25(24)31-26(23)14-21(20)17-29(28,3)4;1-4(6)3-5(2)7;/h5-8,10-15H,16-17H2,1-4H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | VYNKVYLHXUOCGF-LWFKIUJUSA-N |
| XLogP | 9.26 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.94 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|