C30H25IrN2O4S- — CID 170678564
(Z)-4-hydroxypent-3-en-2-one;iridium;5-(4-nitrobenzene-6-id-1-yl)-12-thia-6-azapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),3,5,7,9,14,20-octaene (PubChem CID 170678564) has the molecular formula C30H25IrN2O4S- and a molecular weight of 701.82 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;5-(4-nitrobenzene-6-id-1-yl)-12-thia-6-azapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),3,5,7,9,14,20-octaene.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;5-(4-nitrobenzene-6-id-1-yl)-12-thia-6-azapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),3,5,7,9,14,20-octaene |
|---|---|
| PubChem CID | 170678564 |
| Molecular Formula | C30H25IrN2O4S- |
| Molecular Weight | 701.82 g/mol |
| Exact Mass | 702.12 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;5-(4-nitrobenzene-6-id-1-yl)-12-thia-6-azapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),3,5,7,9,14,20-octaene |
| SMILES | CC(=O)/C=C(/C)O.O=[N+]([O-])c1c[c-]c(-c2nccc3cc4sc5cc6c(cc5c4cc23)CCCC6)cc1.[Ir] |
| InChI | InChI=1S/C25H17N2O2S.C5H8O2.Ir/c28-27(29)19-7-5-15(6-8-19)25-20-14-22-21-11-16-3-1-2-4-17(16)12-23(21)30-24(22)13-18(20)9-10-26-25;1-4(6)3-5(2)7;/h5,7-14H,1-4H2;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | DPBOIJBABMPZCO-LWFKIUJUSA-N |
| XLogP | 7.89 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.82 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|