C34H31IrN2O2Si- — CID 176878560
(Z)-4-hydroxypent-3-en-2-one;iridium;3-[6-(3-trimethylsilylphenyl)isoquinolin-1-yl]-4H-naphthalen-4-ide-1-carbonitrile (PubChem CID 176878560) has the molecular formula C34H31IrN2O2Si- and a molecular weight of 719.94 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;3-[6-(3-trimethylsilylphenyl)isoquinolin-1-yl]-4H-naphthalen-4-ide-1-carbonitrile.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;3-[6-(3-trimethylsilylphenyl)isoquinolin-1-yl]-4H-naphthalen-4-ide-1-carbonitrile |
|---|---|
| PubChem CID | 176878560 |
| Molecular Formula | C34H31IrN2O2Si- |
| Molecular Weight | 719.94 g/mol |
| Exact Mass | 720.18 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;3-[6-(3-trimethylsilylphenyl)isoquinolin-1-yl]-4H-naphthalen-4-ide-1-carbonitrile |
| SMILES | CC(=O)/C=C(/C)O.C[Si](C)(C)c1cccc(-c2ccc3c(-c4[c-]c5ccccc5c(C#N)c4)nccc3c2)c1.[Ir] |
| InChI | InChI=1S/C29H23N2Si.C5H8O2.Ir/c1-32(2,3)26-9-6-8-20(18-26)21-11-12-28-23(15-21)13-14-31-29(28)24-16-22-7-4-5-10-27(22)25(17-24)19-30;1-4(6)3-5(2)7;/h4-15,17-18H,1-3H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | HCTYQRWLYKLIGA-LWFKIUJUSA-N |
| XLogP | 7.97 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.94 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|